C16H13NO4 — CID 66461659
1-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)ethanol (PubChem CID 66461659) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)ethanol |
|---|---|
| PubChem CID | 66461659 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(1,3-benzoxazol-2-yl)ethanol |
| SMILES | OC(Cc1nc2ccccc2o1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13NO4/c18-12(10-5-6-14-15(7-10)20-9-19-14)8-16-17-11-3-1-2-4-13(11)21-16/h1-7,12,18H,8-9H2 |
| InChIKey | FUMJEPBWSZDXPD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |