C15H24N2O2 — CID 66471944
2-tert-butyl-4,5,5a,6,7,8,9,9a-octahydro-3aH-imidazo[1,5-a]quinoline-1,3-dione (PubChem CID 66471944) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-tert-butyl-4,5,5a,6,7,8,9,9a-octahydro-3aH-imidazo[1,5-a]quinoline-1,3-dione.
| Compound Name | 2-tert-butyl-4,5,5a,6,7,8,9,9a-octahydro-3aH-imidazo[1,5-a]quinoline-1,3-dione |
|---|---|
| PubChem CID | 66471944 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-tert-butyl-4,5,5a,6,7,8,9,9a-octahydro-3aH-imidazo[1,5-a]quinoline-1,3-dione |
| SMILES | CC(C)(C)N1C(=O)C2CCC3CCCCC3N2C1=O |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,3)17-13(18)12-9-8-10-6-4-5-7-11(10)16(12)14(17)19/h10-12H,4-9H2,1-3H3 |
| InChIKey | UKSCTGJBWIBLJI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|