C20H23N3O6 — CID 66547547
2-(diethylamino)-2-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]propanoic acid (PubChem CID 66547547) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(diethylamino)-2-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]propanoic acid.
| Compound Name | 2-(diethylamino)-2-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 66547547 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-(diethylamino)-2-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]propanoic acid |
| SMILES | CCN(CC)C(C)(C(=O)O)N1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C20H23N3O6/c1-4-21(5-2)20(3,19(28)29)23-15(24)11-10-14(18(23)27)22-16(25)12-8-6-7-9-13(12)17(22)26/h6-9,14H,4-5,10-11H2,1-3H3,(H,28,29) |
| InChIKey | JUSUFVISFLBWQN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|