C26H29NO8 — CID 66561282
[(3aS,4R,5R)-5-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazol-4-yl]methyl butanoate (PubChem CID 66561282) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is [(3aS,4R,5R)-5-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazol-4-yl]methyl butanoate.
| Compound Name | [(3aS,4R,5R)-5-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazol-4-yl]methyl butanoate |
|---|---|
| PubChem CID | 66561282 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [(3aS,4R,5R)-5-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazol-4-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@H]1[C@H](c2cc(OC)c(OC)c(OC)c2)c2cc3c(cc2C2=NOC[C@H]21)OCO3 |
| InChI | InChI=1S/C26H29NO8/c1-5-6-23(28)32-11-17-18-12-35-27-25(18)16-10-20-19(33-13-34-20)9-15(16)24(17)14-7-21(29-2)26(31-4)22(8-14)30-3/h7-10,17-18,24H,5-6,11-13H2,1-4H3/t17-,18-,24+/m0/s1 |
| InChIKey | UASYUUCGXADMJL-LLJLJFOGSA-N |
| XLogP | 3.90 |
| TPSA | 94.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |