C27H21N3O6 — CID 11260238
methyl (3aS,4R,5R)-5-(4-methoxyphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate (PubChem CID 11260238) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is methyl (3aS,4R,5R)-5-(4-methoxyphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate.
| Compound Name | methyl (3aS,4R,5R)-5-(4-methoxyphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 11260238 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl (3aS,4R,5R)-5-(4-methoxyphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2cc(OC)c3nc4ccccc4nc3c2)c2cc3c(cc2C2=NOC[C@H]21)OCO3 |
| InChI | InChI=1S/C27H21N3O6/c1-32-22-8-13(7-19-26(22)29-18-6-4-3-5-17(18)28-19)23-14-9-20-21(35-12-34-20)10-15(14)25-16(11-36-30-25)24(23)27(31)33-2/h3-10,16,23-24H,11-12H2,1-2H3/t16-,23+,24-/m0/s1 |
| InChIKey | HBBGXJQUCXGWAP-GHEQTVGYSA-N |
| XLogP | 3.81 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|