C29H25N3O6 — CID 11398133
methyl (3aS,4R,5R)-5-(4-methoxy-7,8-dimethylphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate (PubChem CID 11398133) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is methyl (3aS,4R,5R)-5-(4-methoxy-7,8-dimethylphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate.
| Compound Name | methyl (3aS,4R,5R)-5-(4-methoxy-7,8-dimethylphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 11398133 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | methyl (3aS,4R,5R)-5-(4-methoxy-7,8-dimethylphenazin-2-yl)-3,3a,4,5-tetrahydro-[1,3]benzodioxolo[6,5-g][2,1]benzoxazole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2cc(OC)c3nc4cc(C)c(C)cc4nc3c2)c2cc3c(cc2C2=NOC[C@H]21)OCO3 |
| InChI | InChI=1S/C29H25N3O6/c1-13-5-19-20(6-14(13)2)31-28-21(30-19)7-15(8-24(28)34-3)25-16-9-22-23(37-12-36-22)10-17(16)27-18(11-38-32-27)26(25)29(33)35-4/h5-10,18,25-26H,11-12H2,1-4H3/t18-,25+,26-/m0/s1 |
| InChIKey | OEKHNVWTSXLHPY-IMDCKVJKSA-N |
| XLogP | 4.42 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|