C22H30N10O2 — CID 66582192
2-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]morpholine-4-carboximidamide (PubChem CID 66582192) has the molecular formula C22H30N10O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]morpholine-4-carboximidamide.
| Compound Name | 2-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 66582192 |
| Molecular Formula | C22H30N10O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]morpholine-4-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCOC(c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)C1 |
| InChI | InChI=1S/C22H30N10O2/c23-20(24)28-7-1-6-27-11-14-2-4-16(5-3-14)32-12-15-10-17(29-19(15)30-22(32)33)18-13-31(21(25)26)8-9-34-18/h2-5,10,12,18,27H,1,6-9,11,13H2,(H3,25,26)(H4,23,24,28)(H,29,30,33) |
| InChIKey | OIHSEALWXSGTNT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 189.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|