C26H19Cl2NO5 — CID 66600655
(1R,2R,9R,12R,13R,14S)-N-(3,4-dichlorophenyl)-2-hydroxy-11-oxo-14-phenyl-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide (PubChem CID 66600655) has the molecular formula C26H19Cl2NO5 and a molecular weight of 496.35 g/mol. Its IUPAC name is (1R,2R,9R,12R,13R,14S)-N-(3,4-dichlorophenyl)-2-hydroxy-11-oxo-14-phenyl-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide.
| Compound Name | (1R,2R,9R,12R,13R,14S)-N-(3,4-dichlorophenyl)-2-hydroxy-11-oxo-14-phenyl-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide |
|---|---|
| PubChem CID | 66600655 |
| Molecular Formula | C26H19Cl2NO5 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | (1R,2R,9R,12R,13R,14S)-N-(3,4-dichlorophenyl)-2-hydroxy-11-oxo-14-phenyl-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@H]1[C@@H](c2ccccc2)O[C@]23[C@H](O)c4ccccc4[C@H]2OC(=O)[C@H]13 |
| InChI | InChI=1S/C26H19Cl2NO5/c27-17-11-10-14(12-18(17)28)29-24(31)19-20-25(32)33-23-16-9-5-4-8-15(16)22(30)26(20,23)34-21(19)13-6-2-1-3-7-13/h1-12,19-23,30H,(H,29,31)/t19-,20+,21-,22-,23-,26-/m1/s1 |
| InChIKey | SJCQIKMJLOJSKF-PVLBTEPASA-N |
| XLogP | 5.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |