About benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate
benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 66620506) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate |
| PubChem CID | 66620506 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC1(c2nc3cccc(C(N)=O)c3o2)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c1-21(19-23-16-10-5-9-15(18(22)25)17(16)28-19)11-6-12-24(21)20(26)27-13-14-7-3-2-4-8-14/h2-5,7-10H,6,11-13H2,1H3,(H2,22,25) |
| InChIKey | CFLZWAAEONPACH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate (CID 66620506) is benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate is CC1(c2nc3cccc(C(N)=O)c3o2)CCCN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate?
The InChIKey is CFLZWAAEONPACH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-21(19-23-16-10-5-9-15(18(22)25)17(16)28-19)11-6-12-24(21)20(26)27-13-14-7-3-2-4-8-14/h2-5,7-10H,6,11-13H2,1H3,(H2,22,25).
What are the key properties of benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate?
benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate has a molecular weight of 379.42 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(7-carbamoyl-1,3-benzoxazol-2-yl)-2-methylpyrrolidine-1-carboxylate is sourced from PubChem (CID 66620506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).