C14H17N5O2 — CID 24777003
benzyl (2S)-2-methyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 24777003) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is benzyl (2S)-2-methyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-methyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24777003 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | benzyl (2S)-2-methyl-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | C[C@@]1(c2nn[nH]n2)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17N5O2/c1-14(12-15-17-18-16-12)8-5-9-19(14)13(20)21-10-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3,(H,15,16,17,18)/t14-/m0/s1 |
| InChIKey | KGAFMELTDCBRTH-AWEZNQCLSA-N |
| XLogP | 1.85 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |