C12H31NO3Si3 — CID 66657024
trimethoxy-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]silane (PubChem CID 66657024) has the molecular formula C12H31NO3Si3 and a molecular weight of 321.64 g/mol. Its IUPAC name is trimethoxy-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]silane.
| Compound Name | trimethoxy-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]silane |
|---|---|
| PubChem CID | 66657024 |
| Molecular Formula | C12H31NO3Si3 |
| Molecular Weight | 321.64 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | trimethoxy-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]silane |
| SMILES | CO[Si](CCCN1[Si](C)(C)CC[Si]1(C)C)(OC)OC |
| InChI | InChI=1S/C12H31NO3Si3/c1-14-19(15-2,16-3)10-8-9-13-17(4,5)11-12-18(13,6)7/h8-12H2,1-7H3 |
| InChIKey | UXDUWXHXCWUEJC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|