C10H24INSi2 — CID 163651267
methylidene-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]-λ3-iodane (PubChem CID 163651267) has the molecular formula C10H24INSi2 and a molecular weight of 341.39 g/mol. Its IUPAC name is methylidene-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]-λ3-iodane.
| Compound Name | methylidene-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]-λ3-iodane |
|---|---|
| PubChem CID | 163651267 |
| Molecular Formula | C10H24INSi2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methylidene-[3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)propyl]-λ3-iodane |
| SMILES | C=ICCCN1[Si](C)(C)CC[Si]1(C)C |
| InChI | InChI=1S/C10H24INSi2/c1-11-7-6-8-12-13(2,3)9-10-14(12,4)5/h1,6-10H2,2-5H3 |
| InChIKey | IMLLRGUDNVKNJE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|