C12H28KNOSi2 — CID 158101813
potassium 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-olate (PubChem CID 158101813) has the molecular formula C12H28KNOSi2 and a molecular weight of 297.63 g/mol. Its IUPAC name is potassium 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-olate.
| Compound Name | potassium 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-olate |
|---|---|
| PubChem CID | 158101813 |
| Molecular Formula | C12H28KNOSi2 |
| Molecular Weight | 297.63 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | potassium 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-olate |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1CCCCCC[O-].[K+] |
| InChI | InChI=1S/C12H28NOSi2.K/c1-15(2)11-12-16(3,4)13(15)9-7-5-6-8-10-14;/h5-12H2,1-4H3;/q-1;+1 |
| InChIKey | SCIDCPOIJXPNFU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.63 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|