C11H23NSi2 — CID 159579754
2,2,5,5-tetramethyl-1-pent-4-ynyl-1,2,5-azadisilolidine (PubChem CID 159579754) has the molecular formula C11H23NSi2 and a molecular weight of 225.48 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1-pent-4-ynyl-1,2,5-azadisilolidine.
| Compound Name | 2,2,5,5-tetramethyl-1-pent-4-ynyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 159579754 |
| Molecular Formula | C11H23NSi2 |
| Molecular Weight | 225.48 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2,2,5,5-tetramethyl-1-pent-4-ynyl-1,2,5-azadisilolidine |
| SMILES | C#CCCCN1[Si](C)(C)CC[Si]1(C)C |
| InChI | InChI=1S/C11H23NSi2/c1-6-7-8-9-12-13(2,3)10-11-14(12,4)5/h1H,7-11H2,2-5H3 |
| InChIKey | WLHPVJXFRHPHAJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|