C16H10FNO3 — CID 66659114
7-(3-fluorophenyl)-8H-[1,3]dioxolo[4,5-f]quinolin-9-one (PubChem CID 66659114) has the molecular formula C16H10FNO3 and a molecular weight of 283.26 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-8H-[1,3]dioxolo[4,5-f]quinolin-9-one.
| Compound Name | 7-(3-fluorophenyl)-8H-[1,3]dioxolo[4,5-f]quinolin-9-one |
|---|---|
| PubChem CID | 66659114 |
| Molecular Formula | C16H10FNO3 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 7-(3-fluorophenyl)-8H-[1,3]dioxolo[4,5-f]quinolin-9-one |
| SMILES | O=C1CC(c2cccc(F)c2)=Nc2ccc3c(c21)OCO3 |
| InChI | InChI=1S/C16H10FNO3/c17-10-3-1-2-9(6-10)12-7-13(19)15-11(18-12)4-5-14-16(15)21-8-20-14/h1-6H,7-8H2 |
| InChIKey | CSAAYMAWMGDWJK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |