C20H34BN3O3 — CID 66667616
N,N-ditert-butyl-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide (PubChem CID 66667616) has the molecular formula C20H34BN3O3 and a molecular weight of 375.32 g/mol. Its IUPAC name is N,N-ditert-butyl-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide.
| Compound Name | N,N-ditert-butyl-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 66667616 |
| Molecular Formula | C20H34BN3O3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N,N-ditert-butyl-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N(C(C)(C)C)C(C)(C)C)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H34BN3O3/c1-13-14(21-26-19(8,9)20(10,11)27-21)12-22-15(23-13)16(25)24(17(2,3)4)18(5,6)7/h12H,1-11H3 |
| InChIKey | PDXRVSDJIDMBAU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|