C26H32O4Sn — CID 66672564
2,3-dibenzylbut-2-enedioate;ditert-butyltin(2+) (PubChem CID 66672564) has the molecular formula C26H32O4Sn and a molecular weight of 527.25 g/mol. Its IUPAC name is 2,3-dibenzylbut-2-enedioate;ditert-butyltin(2+).
| Compound Name | 2,3-dibenzylbut-2-enedioate;ditert-butyltin(2+) |
|---|---|
| PubChem CID | 66672564 |
| Molecular Formula | C26H32O4Sn |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2,3-dibenzylbut-2-enedioate;ditert-butyltin(2+) |
| SMILES | CC(C)(C)[Sn+2]C(C)(C)C.O=C([O-])C(Cc1ccccc1)=C(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C18H16O4.2C4H9.Sn/c19-17(20)15(11-13-7-3-1-4-8-13)16(18(21)22)12-14-9-5-2-6-10-14;2*1-4(2)3;/h1-10H,11-12H2,(H,19,20)(H,21,22);2*1-3H3;/q;;;+2/p-2 |
| InChIKey | OUUAWSMMZYPBNP-UHFFFAOYSA-L |
| XLogP | 3.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|