C19H29NO6 — CID 66674886
2-[adamantane-1-carbonyloxymethoxycarbonyl(tert-butyl)amino]acetic acid (PubChem CID 66674886) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-[adamantane-1-carbonyloxymethoxycarbonyl(tert-butyl)amino]acetic acid.
| Compound Name | 2-[adamantane-1-carbonyloxymethoxycarbonyl(tert-butyl)amino]acetic acid |
|---|---|
| PubChem CID | 66674886 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-[adamantane-1-carbonyloxymethoxycarbonyl(tert-butyl)amino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)C(=O)OCOC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H29NO6/c1-18(2,3)20(10-15(21)22)17(24)26-11-25-16(23)19-7-12-4-13(8-19)6-14(5-12)9-19/h12-14H,4-11H2,1-3H3,(H,21,22) |
| InChIKey | PNXJMSFGLRAKGS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|