C19H15ClN2O3 — CID 66677509
2-[(Z)-3-(3-chlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione (PubChem CID 66677509) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-[(Z)-3-(3-chlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-3-(3-chlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 66677509 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-[(Z)-3-(3-chlorophenyl)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]isoindole-1,3-dione |
| SMILES | CN(C)/C=C(/C(=O)c1cccc(Cl)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15ClN2O3/c1-21(2)11-16(17(23)12-6-5-7-13(20)10-12)22-18(24)14-8-3-4-9-15(14)19(22)25/h3-11H,1-2H3/b16-11- |
| InChIKey | OHFHDOFRMHCGST-WJDWOHSUSA-N |
| XLogP | 3.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|