C18H22BrN — CID 66678570
1-[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]indole (PubChem CID 66678570) has the molecular formula C18H22BrN and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]indole.
| Compound Name | 1-[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]indole |
|---|---|
| PubChem CID | 66678570 |
| Molecular Formula | C18H22BrN |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-[(2E,6E)-8-bromo-2,6-dimethylocta-2,6-dienyl]indole |
| SMILES | C/C(=C\CBr)CC/C=C(\C)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C18H22BrN/c1-15(10-12-19)6-5-7-16(2)14-20-13-11-17-8-3-4-9-18(17)20/h3-4,7-11,13H,5-6,12,14H2,1-2H3/b15-10+,16-7+ |
| InChIKey | SGDRNUWTLNHZLM-HRYPAVBKSA-N |
| XLogP | 5.71 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|