C28H33ClN2O4S — CID 66689364
N-(3-chloro-2-methylphenyl)sulfonyl-3-[3-[4-(3-phenylpropoxy)phenyl]propylamino]propanamide (PubChem CID 66689364) has the molecular formula C28H33ClN2O4S and a molecular weight of 529.10 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)sulfonyl-3-[3-[4-(3-phenylpropoxy)phenyl]propylamino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-[3-[4-(3-phenylpropoxy)phenyl]propylamino]propanamide |
|---|---|
| PubChem CID | 66689364 |
| Molecular Formula | C28H33ClN2O4S |
| Molecular Weight | 529.10 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-[3-[4-(3-phenylpropoxy)phenyl]propylamino]propanamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NC(=O)CCNCCCc1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H33ClN2O4S/c1-22-26(29)12-5-13-27(22)36(33,34)31-28(32)18-20-30-19-6-10-24-14-16-25(17-15-24)35-21-7-11-23-8-3-2-4-9-23/h2-5,8-9,12-17,30H,6-7,10-11,18-21H2,1H3,(H,31,32) |
| InChIKey | NBBYNCCIKHSIBK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.10 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|