C32H45NO2 — CID 66702233
2-cyano-5-ethyl-2-(2-ethylhexyl)-3,3-diphenylnonanoic acid (PubChem CID 66702233) has the molecular formula C32H45NO2 and a molecular weight of 475.72 g/mol. Its IUPAC name is 2-cyano-5-ethyl-2-(2-ethylhexyl)-3,3-diphenylnonanoic acid.
| Compound Name | 2-cyano-5-ethyl-2-(2-ethylhexyl)-3,3-diphenylnonanoic acid |
|---|---|
| PubChem CID | 66702233 |
| Molecular Formula | C32H45NO2 |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.35 |
| IUPAC Name | 2-cyano-5-ethyl-2-(2-ethylhexyl)-3,3-diphenylnonanoic acid |
| SMILES | CCCCC(CC)CC(C#N)(C(=O)O)C(CC(CC)CCCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H45NO2/c1-5-9-17-26(7-3)23-31(25-33,30(34)35)32(28-19-13-11-14-20-28,29-21-15-12-16-22-29)24-27(8-4)18-10-6-2/h11-16,19-22,26-27H,5-10,17-18,23-24H2,1-4H3,(H,34,35) |
| InChIKey | QSDPFWLBGUPPOQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |