C17H16Cl2N2O3 — CID 66724787
(3R)-4-amino-3-[4-chloro-3-(3-cyano-5-hydroxyphenyl)phenyl]butanoic acid;hydrochloride (PubChem CID 66724787) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is (3R)-4-amino-3-[4-chloro-3-(3-cyano-5-hydroxyphenyl)phenyl]butanoic acid;hydrochloride.
| Compound Name | (3R)-4-amino-3-[4-chloro-3-(3-cyano-5-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66724787 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (3R)-4-amino-3-[4-chloro-3-(3-cyano-5-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
| SMILES | Cl.N#Cc1cc(O)cc(-c2cc([C@H](CN)CC(=O)O)ccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O3.ClH/c18-16-2-1-11(13(9-20)7-17(22)23)6-15(16)12-3-10(8-19)4-14(21)5-12;/h1-6,13,21H,7,9,20H2,(H,22,23);1H/t13-;/m0./s1 |
| InChIKey | ZSNJWDMMVVTVOG-ZOWNYOTGSA-N |
| XLogP | 3.52 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |