C16H17Cl2NO3 — CID 66724800
(3R)-4-amino-3-[4-chloro-3-(3-hydroxyphenyl)phenyl]butanoic acid;hydrochloride (PubChem CID 66724800) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is (3R)-4-amino-3-[4-chloro-3-(3-hydroxyphenyl)phenyl]butanoic acid;hydrochloride.
| Compound Name | (3R)-4-amino-3-[4-chloro-3-(3-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66724800 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (3R)-4-amino-3-[4-chloro-3-(3-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
| SMILES | Cl.NC[C@H](CC(=O)O)c1ccc(Cl)c(-c2cccc(O)c2)c1 |
| InChI | InChI=1S/C16H16ClNO3.ClH/c17-15-5-4-10(12(9-18)8-16(20)21)7-14(15)11-2-1-3-13(19)6-11;/h1-7,12,19H,8-9,18H2,(H,20,21);1H/t12-;/m0./s1 |
| InChIKey | XBPUEXGRHPYNFN-YDALLXLXSA-N |
| XLogP | 3.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |