C34H46N2O4 — CID 66729563
6-amino-N-[(2S)-1,3-dihydroxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]decanamide (PubChem CID 66729563) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 6-amino-N-[(2S)-1,3-dihydroxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]decanamide.
| Compound Name | 6-amino-N-[(2S)-1,3-dihydroxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]decanamide |
|---|---|
| PubChem CID | 66729563 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 6-amino-N-[(2S)-1,3-dihydroxybutan-2-yl]-N-[(4-methoxyphenyl)-diphenylmethyl]decanamide |
| SMILES | CCCCC(N)CCCCC(=O)N([C@@H](CO)C(C)O)C(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C34H46N2O4/c1-4-5-18-30(35)19-12-13-20-33(39)36(32(25-37)26(2)38)34(27-14-8-6-9-15-27,28-16-10-7-11-17-28)29-21-23-31(40-3)24-22-29/h6-11,14-17,21-24,26,30,32,37-38H,4-5,12-13,18-20,25,35H2,1-3H3/t26?,30?,32-/m0/s1 |
| InChIKey | WLIZXBJTIDFKIG-KRGRXRNDSA-N |
| XLogP | 5.64 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|