About CID 66773861
CID 66773861 (PubChem CID 66773861) has the molecular formula C12H10FO2Si
and a molecular weight of 233.29 g/mol.
Molecular Properties
| Compound Name | CID 66773861 |
| PubChem CID | 66773861 |
| Molecular Formula | C12H10FO2Si |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | — |
| SMILES | F[Si](Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H10FO2Si/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H |
| InChIKey | HDPOQFKMJZYTTO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 66773861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66773861?
The IUPAC name of CID 66773861 (CID 66773861) is not available.
What is the SMILES notation for CID 66773861?
The canonical SMILES for CID 66773861 is F[Si](Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of CID 66773861?
The InChIKey is HDPOQFKMJZYTTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FO2Si/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H.
What are the key properties of CID 66773861?
CID 66773861 has a molecular weight of 233.29 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66773861 is sourced from PubChem (CID 66773861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).