C20H20IN3O3 — CID 66823726
tert-butyl 5-(4-amino-7-iodofuro[3,2-c]pyridin-3-yl)-2,3-dihydroindole-1-carboxylate (PubChem CID 66823726) has the molecular formula C20H20IN3O3 and a molecular weight of 477.30 g/mol. Its IUPAC name is tert-butyl 5-(4-amino-7-iodofuro[3,2-c]pyridin-3-yl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-(4-amino-7-iodofuro[3,2-c]pyridin-3-yl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 66823726 |
| Molecular Formula | C20H20IN3O3 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | tert-butyl 5-(4-amino-7-iodofuro[3,2-c]pyridin-3-yl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(-c3coc4c(I)cnc(N)c34)ccc21 |
| InChI | InChI=1S/C20H20IN3O3/c1-20(2,3)27-19(25)24-7-6-12-8-11(4-5-15(12)24)13-10-26-17-14(21)9-23-18(22)16(13)17/h4-5,8-10H,6-7H2,1-3H3,(H2,22,23) |
| InChIKey | ZQEBNNXBSVRVJW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|