C21H21N3 — CID 66850997
1,8-dimethyl-9-(3-methyl-1H-pyridin-2-ylidene)fluorene-2,7-diamine (PubChem CID 66850997) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1,8-dimethyl-9-(3-methyl-1H-pyridin-2-ylidene)fluorene-2,7-diamine.
| Compound Name | 1,8-dimethyl-9-(3-methyl-1H-pyridin-2-ylidene)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 66850997 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1,8-dimethyl-9-(3-methyl-1H-pyridin-2-ylidene)fluorene-2,7-diamine |
| SMILES | CC1=CC=CNC1=C1c2c(ccc(N)c2C)-c2ccc(N)c(C)c21 |
| InChI | InChI=1S/C21H21N3/c1-11-5-4-10-24-21(11)20-18-12(2)16(22)8-6-14(18)15-7-9-17(23)13(3)19(15)20/h4-10,24H,22-23H2,1-3H3 |
| InChIKey | CCPVCXKTYMGZOH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|