C20H15BrN2O2S2 — CID 66907283
N-(3-bromo-1-benzothiophen-2-yl)-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 66907283) has the molecular formula C20H15BrN2O2S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is N-(3-bromo-1-benzothiophen-2-yl)-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-(3-bromo-1-benzothiophen-2-yl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66907283 |
| Molecular Formula | C20H15BrN2O2S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | N-(3-bromo-1-benzothiophen-2-yl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccccn1)c1sc2ccccc2c1Br |
| InChI | InChI=1S/C20H15BrN2O2S2/c21-19-17-11-4-5-12-18(17)26-20(19)23(14-15-8-6-7-13-22-15)27(24,25)16-9-2-1-3-10-16/h1-13H,14H2 |
| InChIKey | NLAYVYDPFDGMCR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |