C22H18BrNO2S2 — CID 66907122
N-(3-bromo-1-benzothiophen-2-yl)-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 66907122) has the molecular formula C22H18BrNO2S2 and a molecular weight of 472.43 g/mol. Its IUPAC name is N-(3-bromo-1-benzothiophen-2-yl)-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | N-(3-bromo-1-benzothiophen-2-yl)-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66907122 |
| Molecular Formula | C22H18BrNO2S2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | N-(3-bromo-1-benzothiophen-2-yl)-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(CCc1ccccc1)c1sc2ccccc2c1Br |
| InChI | InChI=1S/C22H18BrNO2S2/c23-21-19-13-7-8-14-20(19)27-22(21)24(16-15-17-9-3-1-4-10-17)28(25,26)18-11-5-2-6-12-18/h1-14H,15-16H2 |
| InChIKey | CQHZSMQOLAVJNZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |