C19H22BrN5O2S2 — CID 76641653
N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(tetrazolidin-5-yl)benzenesulfonamide (PubChem CID 76641653) has the molecular formula C19H22BrN5O2S2 and a molecular weight of 496.46 g/mol. Its IUPAC name is N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(tetrazolidin-5-yl)benzenesulfonamide.
| Compound Name | N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(tetrazolidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 76641653 |
| Molecular Formula | C19H22BrN5O2S2 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(tetrazolidin-5-yl)benzenesulfonamide |
| SMILES | CCCCN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccc(C2NNNN2)cc1 |
| InChI | InChI=1S/C19H22BrN5O2S2/c1-2-3-12-25(19-17(20)15-6-4-5-7-16(15)28-19)29(26,27)14-10-8-13(9-11-14)18-21-23-24-22-18/h4-11,18,21-24H,2-3,12H2,1H3 |
| InChIKey | IWKUIXUENGZSGA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |