C17H13Br2F3N2O2S2 — CID 66907092
4-amino-3-bromo-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 66907092) has the molecular formula C17H13Br2F3N2O2S2 and a molecular weight of 558.24 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 4-amino-3-bromo-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66907092 |
| Molecular Formula | C17H13Br2F3N2O2S2 |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 555.87 |
| IUPAC Name | 4-amino-3-bromo-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(CCC(F)(F)F)c2sc3ccccc3c2Br)cc1Br |
| InChI | InChI=1S/C17H13Br2F3N2O2S2/c18-12-9-10(5-6-13(12)23)28(25,26)24(8-7-17(20,21)22)16-15(19)11-3-1-2-4-14(11)27-16/h1-6,9H,7-8,23H2 |
| InChIKey | ZGLVGWCIXGLKJL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|