C17H14BrF3N2O2S2 — CID 66907339
4-amino-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 66907339) has the molecular formula C17H14BrF3N2O2S2 and a molecular weight of 479.34 g/mol. Its IUPAC name is 4-amino-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66907339 |
| Molecular Formula | C17H14BrF3N2O2S2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 4-amino-N-(3-bromo-1-benzothiophen-2-yl)-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(CCC(F)(F)F)c2sc3ccccc3c2Br)cc1 |
| InChI | InChI=1S/C17H14BrF3N2O2S2/c18-15-13-3-1-2-4-14(13)26-16(15)23(10-9-17(19,20)21)27(24,25)12-7-5-11(22)6-8-12/h1-8H,9-10,22H2 |
| InChIKey | IUJKOAVPZYOQNI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|