C18H16BrNO4S2 — CID 66907444
4-[(3-bromo-1-benzothiophen-2-yl)-propylsulfamoyl]benzoic acid (PubChem CID 66907444) has the molecular formula C18H16BrNO4S2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 4-[(3-bromo-1-benzothiophen-2-yl)-propylsulfamoyl]benzoic acid.
| Compound Name | 4-[(3-bromo-1-benzothiophen-2-yl)-propylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66907444 |
| Molecular Formula | C18H16BrNO4S2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | 4-[(3-bromo-1-benzothiophen-2-yl)-propylsulfamoyl]benzoic acid |
| SMILES | CCCN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H16BrNO4S2/c1-2-11-20(17-16(19)14-5-3-4-6-15(14)25-17)26(23,24)13-9-7-12(8-10-13)18(21)22/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | OQXUVCKPVBBDSB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |