C22H18BrNO3S2 — CID 66907960
N-(3-bromo-1-benzothiophen-2-yl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 66907960) has the molecular formula C22H18BrNO3S2 and a molecular weight of 488.43 g/mol. Its IUPAC name is N-(3-bromo-1-benzothiophen-2-yl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(3-bromo-1-benzothiophen-2-yl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66907960 |
| Molecular Formula | C22H18BrNO3S2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | N-(3-bromo-1-benzothiophen-2-yl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccccc1CN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18BrNO3S2/c1-27-19-13-7-5-9-16(19)15-24(29(25,26)17-10-3-2-4-11-17)22-21(23)18-12-6-8-14-20(18)28-22/h2-14H,15H2,1H3 |
| InChIKey | MKGQLJRNYYZSRZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |