C19H19BrN2O4S2 — CID 66906908
4-[(3-bromo-1-benzothiophen-2-yl)-[2-(dimethylamino)ethyl]sulfamoyl]benzoic acid (PubChem CID 66906908) has the molecular formula C19H19BrN2O4S2 and a molecular weight of 483.41 g/mol. Its IUPAC name is 4-[(3-bromo-1-benzothiophen-2-yl)-[2-(dimethylamino)ethyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[(3-bromo-1-benzothiophen-2-yl)-[2-(dimethylamino)ethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66906908 |
| Molecular Formula | C19H19BrN2O4S2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 4-[(3-bromo-1-benzothiophen-2-yl)-[2-(dimethylamino)ethyl]sulfamoyl]benzoic acid |
| SMILES | CN(C)CCN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H19BrN2O4S2/c1-21(2)11-12-22(18-17(20)15-5-3-4-6-16(15)27-18)28(25,26)14-9-7-13(8-10-14)19(23)24/h3-10H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | ZTNPCILAEKBVAA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |