C19H18BrNO4S2 — CID 66907336
methyl (2R)-3-[benzenesulfonyl-(3-bromo-1-benzothiophen-2-yl)amino]-2-methylpropanoate (PubChem CID 66907336) has the molecular formula C19H18BrNO4S2 and a molecular weight of 468.39 g/mol. Its IUPAC name is methyl (2R)-3-[benzenesulfonyl-(3-bromo-1-benzothiophen-2-yl)amino]-2-methylpropanoate.
| Compound Name | methyl (2R)-3-[benzenesulfonyl-(3-bromo-1-benzothiophen-2-yl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 66907336 |
| Molecular Formula | C19H18BrNO4S2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | methyl (2R)-3-[benzenesulfonyl-(3-bromo-1-benzothiophen-2-yl)amino]-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)CN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrNO4S2/c1-13(19(22)25-2)12-21(27(23,24)14-8-4-3-5-9-14)18-17(20)15-10-6-7-11-16(15)26-18/h3-11,13H,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | SBPBWQLGTJVCJQ-CYBMUJFWSA-N |
| XLogP | 4.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |