C24H22Br2N4O5S3 — CID 88861217
N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)benzenesulfonamide;1-bromopyrrolidine-2,5-dione (PubChem CID 88861217) has the molecular formula C24H22Br2N4O5S3 and a molecular weight of 702.47 g/mol. Its IUPAC name is N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)benzenesulfonamide;1-bromopyrrolidine-2,5-dione.
| Compound Name | N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)benzenesulfonamide;1-bromopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 88861217 |
| Molecular Formula | C24H22Br2N4O5S3 |
| Molecular Weight | 702.47 g/mol |
| Exact Mass | 699.91 |
| IUPAC Name | N-(3-bromo-1-benzothiophen-2-yl)-N-butyl-4-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)benzenesulfonamide;1-bromopyrrolidine-2,5-dione |
| SMILES | CCCCN(c1sc2ccccc2c1Br)S(=O)(=O)c1ccc(-c2nc(=S)o[nH]2)cc1.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C20H18BrN3O3S3.C4H4BrNO2/c1-2-3-12-24(19-17(21)15-6-4-5-7-16(15)29-19)30(25,26)14-10-8-13(9-11-14)18-22-20(28)27-23-18;5-6-3(7)1-2-4(6)8/h4-11H,2-3,12H2,1H3,(H,22,23,28);1-2H2 |
| InChIKey | PTTHULYPUFQEAG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|