C14H12N2O6S2 — CID 66917885
2-[(3-oxo-4H-1,4-benzoxazin-5-yl)oxy]-N-thiophen-2-ylsulfonylacetamide (PubChem CID 66917885) has the molecular formula C14H12N2O6S2 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[(3-oxo-4H-1,4-benzoxazin-5-yl)oxy]-N-thiophen-2-ylsulfonylacetamide.
| Compound Name | 2-[(3-oxo-4H-1,4-benzoxazin-5-yl)oxy]-N-thiophen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 66917885 |
| Molecular Formula | C14H12N2O6S2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 2-[(3-oxo-4H-1,4-benzoxazin-5-yl)oxy]-N-thiophen-2-ylsulfonylacetamide |
| SMILES | O=C1COc2cccc(OCC(=O)NS(=O)(=O)c3cccs3)c2N1 |
| InChI | InChI=1S/C14H12N2O6S2/c17-11-7-21-9-3-1-4-10(14(9)15-11)22-8-12(18)16-24(19,20)13-5-2-6-23-13/h1-6H,7-8H2,(H,15,17)(H,16,18) |
| InChIKey | ZBHQNJXVPIBBIU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |