C16H20IN3O2 — CID 66945735
N-[2-(diethylamino)ethyl]-6-iodo-4-oxo-1H-quinoline-8-carboxamide (PubChem CID 66945735) has the molecular formula C16H20IN3O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-iodo-4-oxo-1H-quinoline-8-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-6-iodo-4-oxo-1H-quinoline-8-carboxamide |
|---|---|
| PubChem CID | 66945735 |
| Molecular Formula | C16H20IN3O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-iodo-4-oxo-1H-quinoline-8-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(I)cc2c(=O)cc[nH]c12 |
| InChI | InChI=1S/C16H20IN3O2/c1-3-20(4-2)8-7-19-16(22)13-10-11(17)9-12-14(21)5-6-18-15(12)13/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | OQQDONBSUYVQFH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|