C23H34O6 — CID 66956356
4,4-dicyclopentyl-2-methyl-5-methylidenehex-2-enedioic acid;methyl 2-methylprop-2-enoate (PubChem CID 66956356) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 4,4-dicyclopentyl-2-methyl-5-methylidenehex-2-enedioic acid;methyl 2-methylprop-2-enoate.
| Compound Name | 4,4-dicyclopentyl-2-methyl-5-methylidenehex-2-enedioic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66956356 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4,4-dicyclopentyl-2-methyl-5-methylidenehex-2-enedioic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C(=O)O)C(C=C(C)C(=O)O)(C1CCCC1)C1CCCC1.C=C(C)C(=O)OC |
| InChI | InChI=1S/C18H26O4.C5H8O2/c1-12(16(19)20)11-18(13(2)17(21)22,14-7-3-4-8-14)15-9-5-6-10-15;1-4(2)5(6)7-3/h11,14-15H,2-10H2,1H3,(H,19,20)(H,21,22);1H2,2-3H3 |
| InChIKey | GPLHQOSIYYJVOJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|