C8H4N2O3 — CID 66963304
3-cyano-4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 66963304) has the molecular formula C8H4N2O3 and a molecular weight of 176.13 g/mol. Its IUPAC name is 3-cyano-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 3-cyano-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 66963304 |
| Molecular Formula | C8H4N2O3 |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 3-cyano-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | N#Cc1coc2cc(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C8H4N2O3/c9-2-4-3-13-6-1-5(8(11)12)10-7(4)6/h1,3,10H,(H,11,12) |
| InChIKey | KFHSHROQKJEWRI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |