C45H39N3O8S — CID 6698413
benzyl N-[1-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6698413) has the molecular formula C45H39N3O8S and a molecular weight of 781.89 g/mol. Its IUPAC name is benzyl N-[1-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6698413 |
| Molecular Formula | C45H39N3O8S |
| Molecular Weight | 781.89 g/mol |
| Exact Mass | 781.25 |
| IUPAC Name | benzyl N-[1-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(c2cccc([C@@H]3O[C@H](CSc4nc(-c5ccccc5)c(-c5ccccc5)o4)C[C@H](c4ccc(CO)cc4)O3)c2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H39N3O8S/c49-26-29-19-21-31(22-20-29)38-24-36(28-57-45-47-40(32-13-6-2-7-14-32)41(56-45)33-15-8-3-9-16-33)54-43(55-38)34-17-10-18-35(23-34)48-39(50)25-37(42(48)51)46-44(52)53-27-30-11-4-1-5-12-30/h1-23,36-38,43,49H,24-28H2,(H,46,52)/t36-,37?,38+,43+/m0/s1 |
| InChIKey | OMTXOKCUHAWWHW-OTVYHOPGSA-N |
| XLogP | 8.40 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.89 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|