C26H32N2O4 — CID 66987129
(E)-8-[(1-cyclopropylpyrrolidin-3-yl)amino]-7-(naphthalen-2-yloxymethyl)-8-oxooct-6-enoic acid (PubChem CID 66987129) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is (E)-8-[(1-cyclopropylpyrrolidin-3-yl)amino]-7-(naphthalen-2-yloxymethyl)-8-oxooct-6-enoic acid.
| Compound Name | (E)-8-[(1-cyclopropylpyrrolidin-3-yl)amino]-7-(naphthalen-2-yloxymethyl)-8-oxooct-6-enoic acid |
|---|---|
| PubChem CID | 66987129 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (E)-8-[(1-cyclopropylpyrrolidin-3-yl)amino]-7-(naphthalen-2-yloxymethyl)-8-oxooct-6-enoic acid |
| SMILES | O=C(O)CCCC/C=C(\COc1ccc2ccccc2c1)C(=O)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C26H32N2O4/c29-25(30)9-3-1-2-8-21(26(31)27-22-14-15-28(17-22)23-11-12-23)18-32-24-13-10-19-6-4-5-7-20(19)16-24/h4-8,10,13,16,22-23H,1-3,9,11-12,14-15,17-18H2,(H,27,31)(H,29,30)/b21-8+ |
| InChIKey | XVYYAZNKSIJNCX-ODCIPOBUSA-N |
| XLogP | 4.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|