About furo[3,2-b]pyran-2-one
furo[3,2-b]pyran-2-one (PubChem CID 66988439) has the molecular formula C7H4O3
and a molecular weight of 136.11 g/mol. Its IUPAC name is furo[3,2-b]pyran-2-one.
Molecular Properties
| Compound Name | furo[3,2-b]pyran-2-one |
| PubChem CID | 66988439 |
| Molecular Formula | C7H4O3 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.02 |
| IUPAC Name | furo[3,2-b]pyran-2-one |
| SMILES | O=c1cc2occcc-2o1 |
| InChI | InChI=1S/C7H4O3/c8-7-4-6-5(10-7)2-1-3-9-6/h1-4H |
| InChIKey | BIHAGBNPWVAEBC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,2-b]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyran-2-one?
The IUPAC name of furo[3,2-b]pyran-2-one (CID 66988439) is furo[3,2-b]pyran-2-one.
What is the SMILES notation for furo[3,2-b]pyran-2-one?
The canonical SMILES for furo[3,2-b]pyran-2-one is O=c1cc2occcc-2o1.
What is the InChIKey of furo[3,2-b]pyran-2-one?
The InChIKey is BIHAGBNPWVAEBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O3/c8-7-4-6-5(10-7)2-1-3-9-6/h1-4H.
What are the key properties of furo[3,2-b]pyran-2-one?
furo[3,2-b]pyran-2-one has a molecular weight of 136.11 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyran-2-one is sourced from PubChem (CID 66988439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).