C24H16Cl2N2O5S — CID 67008150
2-[1-[4-[(3,4-dichlorophenyl)sulfonylamino]benzoyl]isoquinolin-4-yl]acetic acid (PubChem CID 67008150) has the molecular formula C24H16Cl2N2O5S and a molecular weight of 515.37 g/mol. Its IUPAC name is 2-[1-[4-[(3,4-dichlorophenyl)sulfonylamino]benzoyl]isoquinolin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-[(3,4-dichlorophenyl)sulfonylamino]benzoyl]isoquinolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 67008150 |
| Molecular Formula | C24H16Cl2N2O5S |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 2-[1-[4-[(3,4-dichlorophenyl)sulfonylamino]benzoyl]isoquinolin-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc(C(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H16Cl2N2O5S/c25-20-10-9-17(12-21(20)26)34(32,33)28-16-7-5-14(6-8-16)24(31)23-19-4-2-1-3-18(19)15(13-27-23)11-22(29)30/h1-10,12-13,28H,11H2,(H,29,30) |
| InChIKey | YMPXGIZXNHACLP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |