C24H22N2O4 — CID 67028130
4-[7-ethyl-3-[(6-hydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-5-methoxyindol-1-yl]butanenitrile (PubChem CID 67028130) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[7-ethyl-3-[(6-hydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-5-methoxyindol-1-yl]butanenitrile.
| Compound Name | 4-[7-ethyl-3-[(6-hydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-5-methoxyindol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 67028130 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-[7-ethyl-3-[(6-hydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]-5-methoxyindol-1-yl]butanenitrile |
| SMILES | CCc1cc(OC)cc2c(C=C3Oc4cc(O)ccc4C3=O)cn(CCCC#N)c12 |
| InChI | InChI=1S/C24H22N2O4/c1-3-15-10-18(29-2)13-20-16(14-26(23(15)20)9-5-4-8-25)11-22-24(28)19-7-6-17(27)12-21(19)30-22/h6-7,10-14,27H,3-5,9H2,1-2H3 |
| InChIKey | LMEUBPISTIWPIP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|