C26H32N2 — CID 67039898
3-[2-[6-(dimethylamino)-2-methyl-1H-inden-1-yl]ethyl]-N,N,2-trimethyl-3H-inden-5-amine (PubChem CID 67039898) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 3-[2-[6-(dimethylamino)-2-methyl-1H-inden-1-yl]ethyl]-N,N,2-trimethyl-3H-inden-5-amine.
| Compound Name | 3-[2-[6-(dimethylamino)-2-methyl-1H-inden-1-yl]ethyl]-N,N,2-trimethyl-3H-inden-5-amine |
|---|---|
| PubChem CID | 67039898 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 3-[2-[6-(dimethylamino)-2-methyl-1H-inden-1-yl]ethyl]-N,N,2-trimethyl-3H-inden-5-amine |
| SMILES | CC1=Cc2ccc(N(C)C)cc2C1CCC1C(C)=Cc2ccc(N(C)C)cc21 |
| InChI | InChI=1S/C26H32N2/c1-17-13-19-7-9-21(27(3)4)15-25(19)23(17)11-12-24-18(2)14-20-8-10-22(28(5)6)16-26(20)24/h7-10,13-16,23-24H,11-12H2,1-6H3 |
| InChIKey | GJCFNSTWFXZYAT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|