C24H34N2O6 — CID 67046548
(E)-6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methyl-3-(3-morpholin-4-ylpropyl)hex-4-enoic acid (PubChem CID 67046548) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (E)-6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methyl-3-(3-morpholin-4-ylpropyl)hex-4-enoic acid.
| Compound Name | (E)-6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methyl-3-(3-morpholin-4-ylpropyl)hex-4-enoic acid |
|---|---|
| PubChem CID | 67046548 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (E)-6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methyl-3-(3-morpholin-4-ylpropyl)hex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(N)c1C/C=C(\C)C(CCCN1CCOCC1)CC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C24H34N2O6/c1-15(17(13-20(27)28)5-4-8-26-9-11-31-12-10-26)6-7-18-22(25)21-19(14-32-24(21)29)16(2)23(18)30-3/h6,17H,4-5,7-14,25H2,1-3H3,(H,27,28)/b15-6+ |
| InChIKey | JXCNXFNYOIFRJA-GIDUJCDVSA-N |
| XLogP | 2.95 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|