C27H31KN3O5 — CID 67049462
4-(4-{(e)-3-[6-((e)-2-Carboxy-vinyl)-pyridin-3-yl]-acryloyl}-benzyl)-piperazine-1-carboxylic acid tert-butyl ester potassium salt (PubChem CID 67049462) has the molecular formula C27H31KN3O5 and a molecular weight of 516.66 g/mol.
| Compound Name | 4-(4-{(e)-3-[6-((e)-2-Carboxy-vinyl)-pyridin-3-yl]-acryloyl}-benzyl)-piperazine-1-carboxylic acid tert-butyl ester potassium salt |
|---|---|
| PubChem CID | 67049462 |
| Molecular Formula | C27H31KN3O5 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(C(=O)/C=C/c3ccc(/C=C/C(=O)O)nc3)cc2)CC1.[K] |
| InChI | InChI=1S/C27H31N3O5.K/c1-27(2,3)35-26(34)30-16-14-29(15-17-30)19-21-4-8-22(9-5-21)24(31)12-7-20-6-10-23(28-18-20)11-13-25(32)33;/h4-13,18H,14-17,19H2,1-3H3,(H,32,33);/b12-7+,13-11+; |
| InChIKey | HKEHZTHQTSPLJQ-UDOXVSLPSA-N |
| XLogP | 3.75 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|